C10H12O3S2 — CID 102620882
3,4-dihydro-2H-thiochromen-4-yl methanesulfonate (PubChem CID 102620882) has the molecular formula C10H12O3S2 and a molecular weight of 244.34 g/mol. Its IUPAC name is 3,4-dihydro-2H-thiochromen-4-yl methanesulfonate.
| Compound Name | 3,4-dihydro-2H-thiochromen-4-yl methanesulfonate |
|---|---|
| PubChem CID | 102620882 |
| Molecular Formula | C10H12O3S2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 3,4-dihydro-2H-thiochromen-4-yl methanesulfonate |
| SMILES | CS(=O)(=O)OC1CCSc2ccccc21 |
| InChI | InChI=1S/C10H12O3S2/c1-15(11,12)13-9-6-7-14-10-5-3-2-4-8(9)10/h2-5,9H,6-7H2,1H3 |
| InChIKey | JQSIBECYTRSSQH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|