About ethane;4-methyl-3,4-dihydro-2H-thiochromene
ethane;4-methyl-3,4-dihydro-2H-thiochromene (PubChem CID 143216887) has the molecular formula C12H18S
and a molecular weight of 194.34 g/mol. Its IUPAC name is ethane;4-methyl-3,4-dihydro-2H-thiochromene.
Molecular Properties
| Compound Name | ethane;4-methyl-3,4-dihydro-2H-thiochromene |
| PubChem CID | 143216887 |
| Molecular Formula | C12H18S |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | ethane;4-methyl-3,4-dihydro-2H-thiochromene |
| SMILES | CC.CC1CCSc2ccccc21 |
| InChI | InChI=1S/C10H12S.C2H6/c1-8-6-7-11-10-5-3-2-4-9(8)10;1-2/h2-5,8H,6-7H2,1H3;1-2H3 |
| InChIKey | CMAWXGABQUVHDX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-methyl-3,4-dihydro-2H-thiochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-3,4-dihydro-2H-thiochromene?
The IUPAC name of ethane;4-methyl-3,4-dihydro-2H-thiochromene (CID 143216887) is ethane;4-methyl-3,4-dihydro-2H-thiochromene.
What is the SMILES notation for ethane;4-methyl-3,4-dihydro-2H-thiochromene?
The canonical SMILES for ethane;4-methyl-3,4-dihydro-2H-thiochromene is CC.CC1CCSc2ccccc21.
What is the InChIKey of ethane;4-methyl-3,4-dihydro-2H-thiochromene?
The InChIKey is CMAWXGABQUVHDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12S.C2H6/c1-8-6-7-11-10-5-3-2-4-9(8)10;1-2/h2-5,8H,6-7H2,1H3;1-2H3.
What are the key properties of ethane;4-methyl-3,4-dihydro-2H-thiochromene?
ethane;4-methyl-3,4-dihydro-2H-thiochromene has a molecular weight of 194.34 g/mol, XLogP of 4.31, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-3,4-dihydro-2H-thiochromene is sourced from PubChem (CID 143216887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).