C12H18S — CID 143216887
ethane;4-methyl-3,4-dihydro-2H-thiochromene (PubChem CID 143216887) has the molecular formula C12H18S and a molecular weight of 194.34 g/mol. Its IUPAC name is ethane;4-methyl-3,4-dihydro-2H-thiochromene.
| Compound Name | ethane;4-methyl-3,4-dihydro-2H-thiochromene |
|---|---|
| PubChem CID | 143216887 |
| Molecular Formula | C12H18S |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | ethane;4-methyl-3,4-dihydro-2H-thiochromene |
| SMILES | CC.CC1CCSc2ccccc21 |
| InChI | InChI=1S/C10H12S.C2H6/c1-8-6-7-11-10-5-3-2-4-9(8)10;1-2/h2-5,8H,6-7H2,1H3;1-2H3 |
| InChIKey | CMAWXGABQUVHDX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |