C11H14OS — CID 121216944
7-methoxy-4-methyl-3,4-dihydro-2H-thiochromene (PubChem CID 121216944) has the molecular formula C11H14OS and a molecular weight of 194.30 g/mol. Its IUPAC name is 7-methoxy-4-methyl-3,4-dihydro-2H-thiochromene.
| Compound Name | 7-methoxy-4-methyl-3,4-dihydro-2H-thiochromene |
|---|---|
| PubChem CID | 121216944 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 7-methoxy-4-methyl-3,4-dihydro-2H-thiochromene |
| SMILES | COc1ccc2c(c1)SCCC2C |
| InChI | InChI=1S/C11H14OS/c1-8-5-6-13-11-7-9(12-2)3-4-10(8)11/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | VFQOLTBISVBJAV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |