C10H11FS — CID 144911984
7-fluoro-4-methyl-3,4-dihydro-2H-thiochromene (PubChem CID 144911984) has the molecular formula C10H11FS and a molecular weight of 182.26 g/mol. Its IUPAC name is 7-fluoro-4-methyl-3,4-dihydro-2H-thiochromene.
| Compound Name | 7-fluoro-4-methyl-3,4-dihydro-2H-thiochromene |
|---|---|
| PubChem CID | 144911984 |
| Molecular Formula | C10H11FS |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 7-fluoro-4-methyl-3,4-dihydro-2H-thiochromene |
| SMILES | CC1CCSc2cc(F)ccc21 |
| InChI | InChI=1S/C10H11FS/c1-7-4-5-12-10-6-8(11)2-3-9(7)10/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | ORRQDFLPJVTYLR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |