About ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene
ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene (PubChem CID 142608891) has the molecular formula C14H22S2
and a molecular weight of 254.46 g/mol. Its IUPAC name is ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene.
Molecular Properties
| Compound Name | ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene |
| PubChem CID | 142608891 |
| Molecular Formula | C14H22S2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene |
| SMILES | CC.CCCSC1CCSc2ccccc21 |
| InChI | InChI=1S/C12H16S2.C2H6/c1-2-8-13-12-7-9-14-11-6-4-3-5-10(11)12;1-2/h3-6,12H,2,7-9H2,1H3;1-2H3 |
| InChIKey | RCMNNFPBXXISMU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene?
The IUPAC name of ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene (CID 142608891) is ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene.
What is the SMILES notation for ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene?
The canonical SMILES for ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene is CC.CCCSC1CCSc2ccccc21.
What is the InChIKey of ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene?
The InChIKey is RCMNNFPBXXISMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16S2.C2H6/c1-2-8-13-12-7-9-14-11-6-4-3-5-10(11)12;1-2/h3-6,12H,2,7-9H2,1H3;1-2H3.
What are the key properties of ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene?
ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene has a molecular weight of 254.46 g/mol, XLogP of 5.39, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene is sourced from PubChem (CID 142608891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).