C14H22S2 — CID 142608891
ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene (PubChem CID 142608891) has the molecular formula C14H22S2 and a molecular weight of 254.46 g/mol. Its IUPAC name is ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene.
| Compound Name | ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene |
|---|---|
| PubChem CID | 142608891 |
| Molecular Formula | C14H22S2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | ethane;4-propylsulfanyl-3,4-dihydro-2H-thiochromene |
| SMILES | CC.CCCSC1CCSc2ccccc21 |
| InChI | InChI=1S/C12H16S2.C2H6/c1-2-8-13-12-7-9-14-11-6-4-3-5-10(11)12;1-2/h3-6,12H,2,7-9H2,1H3;1-2H3 |
| InChIKey | RCMNNFPBXXISMU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |