C9H9LiOS — CID 20660965
lithium 3,4-dihydro-2H-thiochromen-4-olate (PubChem CID 20660965) has the molecular formula C9H9LiOS and a molecular weight of 172.18 g/mol. Its IUPAC name is lithium 3,4-dihydro-2H-thiochromen-4-olate.
| Compound Name | lithium 3,4-dihydro-2H-thiochromen-4-olate |
|---|---|
| PubChem CID | 20660965 |
| Molecular Formula | C9H9LiOS |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | lithium 3,4-dihydro-2H-thiochromen-4-olate |
| SMILES | [Li+].[O-]C1CCSc2ccccc21 |
| InChI | InChI=1S/C9H9OS.Li/c10-8-5-6-11-9-4-2-1-3-7(8)9;/h1-4,8H,5-6H2;/q-1;+1 |
| InChIKey | YGAMCPLHGCHODZ-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |