C15H16N2O4S3 — CID 26529063
4-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]benzene-1,4-disulfonamide (PubChem CID 26529063) has the molecular formula C15H16N2O4S3 and a molecular weight of 384.50 g/mol. Its IUPAC name is 4-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]benzene-1,4-disulfonamide.
| Compound Name | 4-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 26529063 |
| Molecular Formula | C15H16N2O4S3 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 4-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]benzene-1,4-disulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)N[C@@H]2CCSc3ccccc32)cc1 |
| InChI | InChI=1S/C15H16N2O4S3/c16-23(18,19)11-5-7-12(8-6-11)24(20,21)17-14-9-10-22-15-4-2-1-3-13(14)15/h1-8,14,17H,9-10H2,(H2,16,18,19)/t14-/m1/s1 |
| InChIKey | IDXIEHCLRVDGST-CQSZACIVSA-N |
| XLogP | 1.85 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |