C15H13FN2O4S2 — CID 51249468
N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-nitrobenzenesulfonamide (PubChem CID 51249468) has the molecular formula C15H13FN2O4S2 and a molecular weight of 368.41 g/mol. Its IUPAC name is N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-nitrobenzenesulfonamide.
| Compound Name | N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 51249468 |
| Molecular Formula | C15H13FN2O4S2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)NC2CCSc3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C15H13FN2O4S2/c16-10-1-6-15-13(9-10)14(7-8-23-15)17-24(21,22)12-4-2-11(3-5-12)18(19)20/h1-6,9,14,17H,7-8H2 |
| InChIKey | KEOJVXZDCQWQCF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|