C17H15FN2O4S — CID 95380317
(4R)-6-fluoro-N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 95380317) has the molecular formula C17H15FN2O4S and a molecular weight of 362.38 g/mol. Its IUPAC name is (4R)-6-fluoro-N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | (4R)-6-fluoro-N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 95380317 |
| Molecular Formula | C17H15FN2O4S |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | (4R)-6-fluoro-N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | O=[N+]([O-])c1cc2c(cc1CN[C@@H]1CCSc3ccc(F)cc31)OCO2 |
| InChI | InChI=1S/C17H15FN2O4S/c18-11-1-2-17-12(6-11)13(3-4-25-17)19-8-10-5-15-16(24-9-23-15)7-14(10)20(21)22/h1-2,5-7,13,19H,3-4,8-9H2/t13-/m1/s1 |
| InChIKey | DKEOIWIVRPNDRC-CYBMUJFWSA-N |
| XLogP | 3.79 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|