C9H11BO2S — CID 175595029
3,4-dihydro-2H-thiochromen-4-ylboronic acid (PubChem CID 175595029) has the molecular formula C9H11BO2S and a molecular weight of 194.06 g/mol. Its IUPAC name is 3,4-dihydro-2H-thiochromen-4-ylboronic acid.
| Compound Name | 3,4-dihydro-2H-thiochromen-4-ylboronic acid |
|---|---|
| PubChem CID | 175595029 |
| Molecular Formula | C9H11BO2S |
| Molecular Weight | 194.06 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 3,4-dihydro-2H-thiochromen-4-ylboronic acid |
| SMILES | OB(O)C1CCSc2ccccc21 |
| InChI | InChI=1S/C9H11BO2S/c11-10(12)8-5-6-13-9-4-2-1-3-7(8)9/h1-4,8,11-12H,5-6H2 |
| InChIKey | ZKZVQTIMSDVQMC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.06 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|