About 1-(azetidin-3-yl)-4-(3,4-dihydro-2H-thiochromen-4-yl)piperazine
1-(azetidin-3-yl)-4-(3,4-dihydro-2H-thiochromen-4-yl)piperazine (PubChem CID 66203482) has the molecular formula C16H23N3S
and a molecular weight of 289.45 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-4-(3,4-dihydro-2H-thiochromen-4-yl)piperazine.
Molecular Properties
| Compound Name | 1-(azetidin-3-yl)-4-(3,4-dihydro-2H-thiochromen-4-yl)piperazine |
| PubChem CID | 66203482 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-(azetidin-3-yl)-4-(3,4-dihydro-2H-thiochromen-4-yl)piperazine |
| SMILES | c1ccc2c(c1)SCCC2N1CCN(C2CNC2)CC1 |
| InChI | InChI=1S/C16H23N3S/c1-2-4-16-14(3-1)15(5-10-20-16)19-8-6-18(7-9-19)13-11-17-12-13/h1-4,13,15,17H,5-12H2 |
| InChIKey | HVEIWSZLXMDXFZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(azetidin-3-yl)-4-(3,4-dihydro-2H-thiochromen-4-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-3-yl)-4-(3,4-dihydro-2H-thiochromen-4-yl)piperazine?
The IUPAC name of 1-(azetidin-3-yl)-4-(3,4-dihydro-2H-thiochromen-4-yl)piperazine (CID 66203482) is 1-(azetidin-3-yl)-4-(3,4-dihydro-2H-thiochromen-4-yl)piperazine.
What is the SMILES notation for 1-(azetidin-3-yl)-4-(3,4-dihydro-2H-thiochromen-4-yl)piperazine?
The canonical SMILES for 1-(azetidin-3-yl)-4-(3,4-dihydro-2H-thiochromen-4-yl)piperazine is c1ccc2c(c1)SCCC2N1CCN(C2CNC2)CC1.
What is the InChIKey of 1-(azetidin-3-yl)-4-(3,4-dihydro-2H-thiochromen-4-yl)piperazine?
The InChIKey is HVEIWSZLXMDXFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3S/c1-2-4-16-14(3-1)15(5-10-20-16)19-8-6-18(7-9-19)13-11-17-12-13/h1-4,13,15,17H,5-12H2.
What are the key properties of 1-(azetidin-3-yl)-4-(3,4-dihydro-2H-thiochromen-4-yl)piperazine?
1-(azetidin-3-yl)-4-(3,4-dihydro-2H-thiochromen-4-yl)piperazine has a molecular weight of 289.45 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-3-yl)-4-(3,4-dihydro-2H-thiochromen-4-yl)piperazine is sourced from PubChem (CID 66203482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).