C24H28N2O4S — CID 6445101
(E)-but-2-enedioic acid;1-phenyl-4-(2,3,4,5-tetrahydro-1-benzothiepin-5-yl)piperazine (PubChem CID 6445101) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-phenyl-4-(2,3,4,5-tetrahydro-1-benzothiepin-5-yl)piperazine.
| Compound Name | (E)-but-2-enedioic acid;1-phenyl-4-(2,3,4,5-tetrahydro-1-benzothiepin-5-yl)piperazine |
|---|---|
| PubChem CID | 6445101 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (E)-but-2-enedioic acid;1-phenyl-4-(2,3,4,5-tetrahydro-1-benzothiepin-5-yl)piperazine |
| SMILES | O=C(O)/C=C/C(=O)O.c1ccc(N2CCN(C3CCCSc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C20H24N2S.C4H4O4/c1-2-7-17(8-3-1)21-12-14-22(15-13-21)19-10-6-16-23-20-11-5-4-9-18(19)20;5-3(6)1-2-4(7)8/h1-5,7-9,11,19H,6,10,12-16H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | QYTWCMIWHDAVTG-WLHGVMLRSA-N |
| XLogP | 4.15 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|