C9H9IS — CID 70353401
4-iodo-3,4-dihydro-2H-thiochromene (PubChem CID 70353401) has the molecular formula C9H9IS and a molecular weight of 276.14 g/mol. Its IUPAC name is 4-iodo-3,4-dihydro-2H-thiochromene.
| Compound Name | 4-iodo-3,4-dihydro-2H-thiochromene |
|---|---|
| PubChem CID | 70353401 |
| Molecular Formula | C9H9IS |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 275.95 |
| IUPAC Name | 4-iodo-3,4-dihydro-2H-thiochromene |
| SMILES | IC1CCSc2ccccc21 |
| InChI | InChI=1S/C9H9IS/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-4,8H,5-6H2 |
| InChIKey | OVSZODDWAUACSM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|