C10H13NS — CID 82409281
3,4-dihydro-2H-thiochromen-4-ylmethanamine (PubChem CID 82409281) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 3,4-dihydro-2H-thiochromen-4-ylmethanamine.
| Compound Name | 3,4-dihydro-2H-thiochromen-4-ylmethanamine |
|---|---|
| PubChem CID | 82409281 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 3,4-dihydro-2H-thiochromen-4-ylmethanamine |
| SMILES | NCC1CCSc2ccccc21 |
| InChI | InChI=1S/C10H13NS/c11-7-8-5-6-12-10-4-2-1-3-9(8)10/h1-4,8H,5-7,11H2 |
| InChIKey | JHGVEOQYLIGEIJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |