C11H10BrF3O3S — CID 102621487
(6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl) trifluoromethanesulfonate (PubChem CID 102621487) has the molecular formula C11H10BrF3O3S and a molecular weight of 359.16 g/mol. Its IUPAC name is (6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl) trifluoromethanesulfonate.
| Compound Name | (6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 102621487 |
| Molecular Formula | C11H10BrF3O3S |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | (6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1CCc2cc(Br)ccc2C1)C(F)(F)F |
| InChI | InChI=1S/C11H10BrF3O3S/c12-9-3-1-8-6-10(4-2-7(8)5-9)18-19(16,17)11(13,14)15/h1,3,5,10H,2,4,6H2 |
| InChIKey | BCUUHVSTIQOIAB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|