C16H20O2S — CID 15497852
(1S,2Z,4R,7R)-4-(benzenesulfinyl)-2-ethylidene-1-methyl-8-oxabicyclo[5.1.0]octane (PubChem CID 15497852) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is (1S,2Z,4R,7R)-4-(benzenesulfinyl)-2-ethylidene-1-methyl-8-oxabicyclo[5.1.0]octane.
| Compound Name | (1S,2Z,4R,7R)-4-(benzenesulfinyl)-2-ethylidene-1-methyl-8-oxabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 15497852 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (1S,2Z,4R,7R)-4-(benzenesulfinyl)-2-ethylidene-1-methyl-8-oxabicyclo[5.1.0]octane |
| SMILES | C/C=C1/C[C@H](S(=O)c2ccccc2)CC[C@H]2O[C@@]12C |
| InChI | InChI=1S/C16H20O2S/c1-3-12-11-14(9-10-15-16(12,2)18-15)19(17)13-7-5-4-6-8-13/h3-8,14-15H,9-11H2,1-2H3/b12-3-/t14-,15-,16+,19?/m1/s1 |
| InChIKey | ZMVRDWMQRPMMIP-DHYXORLSSA-N |
| XLogP | 3.45 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|