C25H30O2S — CID 11761073
(1S,2E,4R,7R)-4-(benzenesulfinyl)-2-benzylidene-1-pentyl-8-oxabicyclo[5.1.0]octane (PubChem CID 11761073) has the molecular formula C25H30O2S and a molecular weight of 394.58 g/mol. Its IUPAC name is (1S,2E,4R,7R)-4-(benzenesulfinyl)-2-benzylidene-1-pentyl-8-oxabicyclo[5.1.0]octane.
| Compound Name | (1S,2E,4R,7R)-4-(benzenesulfinyl)-2-benzylidene-1-pentyl-8-oxabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 11761073 |
| Molecular Formula | C25H30O2S |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (1S,2E,4R,7R)-4-(benzenesulfinyl)-2-benzylidene-1-pentyl-8-oxabicyclo[5.1.0]octane |
| SMILES | CCCCC[C@@]12O[C@@H]1CC[C@@H](S(=O)c1ccccc1)C/C2=C\c1ccccc1 |
| InChI | InChI=1S/C25H30O2S/c1-2-3-10-17-25-21(18-20-11-6-4-7-12-20)19-23(15-16-24(25)27-25)28(26)22-13-8-5-9-14-22/h4-9,11-14,18,23-24H,2-3,10,15-17,19H2,1H3/b21-18+/t23-,24-,25+,28?/m1/s1 |
| InChIKey | WDNIWVHHYRKOCT-LXZJJLNVSA-N |
| XLogP | 6.15 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|