C20H16Br2O6 — CID 23513441
2,3-dihydroxy-2,3-bis(2-methylbenzoyl)butanedioyl dibromide (PubChem CID 23513441) has the molecular formula C20H16Br2O6 and a molecular weight of 512.15 g/mol. Its IUPAC name is 2,3-dihydroxy-2,3-bis(2-methylbenzoyl)butanedioyl dibromide.
| Compound Name | 2,3-dihydroxy-2,3-bis(2-methylbenzoyl)butanedioyl dibromide |
|---|---|
| PubChem CID | 23513441 |
| Molecular Formula | C20H16Br2O6 |
| Molecular Weight | 512.15 g/mol |
| Exact Mass | 509.93 |
| IUPAC Name | 2,3-dihydroxy-2,3-bis(2-methylbenzoyl)butanedioyl dibromide |
| SMILES | Cc1ccccc1C(=O)C(O)(C(=O)Br)C(O)(C(=O)Br)C(=O)c1ccccc1C |
| InChI | InChI=1S/C20H16Br2O6/c1-11-7-3-5-9-13(11)15(23)19(27,17(21)25)20(28,18(22)26)16(24)14-10-6-4-8-12(14)2/h3-10,27-28H,1-2H3 |
| InChIKey | UTEVLEGKHOLLRS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.15 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|