C20H14Cl2O4 — CID 139063258
dimethyl (1R,8R)-3,10-dichlorotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12,15-heptaene-15,16-dicarboxylate (PubChem CID 139063258) has the molecular formula C20H14Cl2O4 and a molecular weight of 389.23 g/mol. Its IUPAC name is dimethyl (1R,8R)-3,10-dichlorotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12,15-heptaene-15,16-dicarboxylate.
| Compound Name | dimethyl (1R,8R)-3,10-dichlorotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12,15-heptaene-15,16-dicarboxylate |
|---|---|
| PubChem CID | 139063258 |
| Molecular Formula | C20H14Cl2O4 |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | dimethyl (1R,8R)-3,10-dichlorotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12,15-heptaene-15,16-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@H]2c3cccc(Cl)c3[C@@H]1c1cccc(Cl)c12 |
| InChI | InChI=1S/C20H14Cl2O4/c1-25-19(23)17-15-9-5-3-8-12(22)14(9)16(18(17)20(24)26-2)10-6-4-7-11(21)13(10)15/h3-8,15-16H,1-2H3/t15-,16-/m0/s1 |
| InChIKey | OEOYVBGORSNSLN-HOTGVXAUSA-N |
| XLogP | 4.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |