C19H25NO4S — CID 71121114
methyl (1R,10S)-13-tert-butylsulfonyliminotricyclo[8.2.1.03,8]trideca-3(8),4,6-triene-5-carboxylate (PubChem CID 71121114) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is methyl (1R,10S)-13-tert-butylsulfonyliminotricyclo[8.2.1.03,8]trideca-3(8),4,6-triene-5-carboxylate.
| Compound Name | methyl (1R,10S)-13-tert-butylsulfonyliminotricyclo[8.2.1.03,8]trideca-3(8),4,6-triene-5-carboxylate |
|---|---|
| PubChem CID | 71121114 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | methyl (1R,10S)-13-tert-butylsulfonyliminotricyclo[8.2.1.03,8]trideca-3(8),4,6-triene-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C[C@H]1CC[C@@H](C2)C1=NS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C19H25NO4S/c1-19(2,3)25(22,23)20-17-13-6-7-14(17)10-16-11-15(18(21)24-4)8-5-12(16)9-13/h5,8,11,13-14H,6-7,9-10H2,1-4H3/t13-,14+/m0/s1 |
| InChIKey | SANPDHYSGOOFIS-UONOGXRCSA-N |
| XLogP | 3.17 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|