C10H10N2O2 — CID 7260871
(3R)-3-(methylamino)-1H-quinoline-2,4-dione (PubChem CID 7260871) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is (3R)-3-(methylamino)-1H-quinoline-2,4-dione.
| Compound Name | (3R)-3-(methylamino)-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 7260871 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | (3R)-3-(methylamino)-1H-quinoline-2,4-dione |
| SMILES | CN[C@H]1C(=O)Nc2ccccc2C1=O |
| InChI | InChI=1S/C10H10N2O2/c1-11-8-9(13)6-4-2-3-5-7(6)12-10(8)14/h2-5,8,11H,1H3,(H,12,14)/t8-/m1/s1 |
| InChIKey | VMJJYFFCWNISEX-MRVPVSSYSA-N |
| XLogP | 0.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|