C18H20N2O — CID 71049033
7-(tert-butylamino)-5,7-dihydrobenzo[d][1]benzazepin-6-one (PubChem CID 71049033) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 7-(tert-butylamino)-5,7-dihydrobenzo[d][1]benzazepin-6-one.
| Compound Name | 7-(tert-butylamino)-5,7-dihydrobenzo[d][1]benzazepin-6-one |
|---|---|
| PubChem CID | 71049033 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 7-(tert-butylamino)-5,7-dihydrobenzo[d][1]benzazepin-6-one |
| SMILES | CC(C)(C)NC1C(=O)Nc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H20N2O/c1-18(2,3)20-16-14-10-5-4-8-12(14)13-9-6-7-11-15(13)19-17(16)21/h4-11,16,20H,1-3H3,(H,19,21) |
| InChIKey | AUEZUNQMJFZYEJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |