C11H10N3O3+ — CID 171377140
(E)-carbamoyl-[[(3S)-2,4-dioxo-1H-quinolin-3-yl]methylidene]azanium (PubChem CID 171377140) has the molecular formula C11H10N3O3+ and a molecular weight of 232.22 g/mol. Its IUPAC name is (E)-carbamoyl-[[(3S)-2,4-dioxo-1H-quinolin-3-yl]methylidene]azanium.
| Compound Name | (E)-carbamoyl-[[(3S)-2,4-dioxo-1H-quinolin-3-yl]methylidene]azanium |
|---|---|
| PubChem CID | 171377140 |
| Molecular Formula | C11H10N3O3+ |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (E)-carbamoyl-[[(3S)-2,4-dioxo-1H-quinolin-3-yl]methylidene]azanium |
| SMILES | NC(=O)/[NH+]=C/[C@@H]1C(=O)Nc2ccccc2C1=O |
| InChI | InChI=1S/C11H9N3O3/c12-11(17)13-5-7-9(15)6-3-1-2-4-8(6)14-10(7)16/h1-5,7H,(H2,12,17)(H,14,16)/p+1/b13-5+/t7-/m0/s1 |
| InChIKey | UKBPBJDLUKEZLS-PBUYIFKYSA-O |
| XLogP | -1.33 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|