C18H22N2O3 — CID 135829360
(5-cycloheptyl-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl) acetate (PubChem CID 135829360) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is (5-cycloheptyl-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl) acetate.
| Compound Name | (5-cycloheptyl-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl) acetate |
|---|---|
| PubChem CID | 135829360 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (5-cycloheptyl-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl) acetate |
| SMILES | CC(=O)OC1N=C(C2CCCCCC2)c2ccccc2NC1=O |
| InChI | InChI=1S/C18H22N2O3/c1-12(21)23-18-17(22)19-15-11-7-6-10-14(15)16(20-18)13-8-4-2-3-5-9-13/h6-7,10-11,13,18H,2-5,8-9H2,1H3,(H,19,22) |
| InChIKey | KWDDLARLPQPGDY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |