C19H13BrO2 — CID 132990926
(3R)-4-bromo-3-(2-hydroxynaphthalen-1-yl)-2,3-dihydroinden-1-one (PubChem CID 132990926) has the molecular formula C19H13BrO2 and a molecular weight of 353.21 g/mol. Its IUPAC name is (3R)-4-bromo-3-(2-hydroxynaphthalen-1-yl)-2,3-dihydroinden-1-one.
| Compound Name | (3R)-4-bromo-3-(2-hydroxynaphthalen-1-yl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 132990926 |
| Molecular Formula | C19H13BrO2 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | (3R)-4-bromo-3-(2-hydroxynaphthalen-1-yl)-2,3-dihydroinden-1-one |
| SMILES | O=C1C[C@H](c2c(O)ccc3ccccc23)c2c(Br)cccc21 |
| InChI | InChI=1S/C19H13BrO2/c20-15-7-3-6-13-17(22)10-14(18(13)15)19-12-5-2-1-4-11(12)8-9-16(19)21/h1-9,14,21H,10H2/t14-/m0/s1 |
| InChIKey | MZFDDNHOSUEXGA-AWEZNQCLSA-N |
| XLogP | 5.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |