C18H14N2O — CID 130474109
3-(quinolin-2-ylmethyl)-2,3-dihydroisoindol-1-one (PubChem CID 130474109) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-(quinolin-2-ylmethyl)-2,3-dihydroisoindol-1-one.
| Compound Name | 3-(quinolin-2-ylmethyl)-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 130474109 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-(quinolin-2-ylmethyl)-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NC(Cc2ccc3ccccc3n2)c2ccccc21 |
| InChI | InChI=1S/C18H14N2O/c21-18-15-7-3-2-6-14(15)17(20-18)11-13-10-9-12-5-1-4-8-16(12)19-13/h1-10,17H,11H2,(H,20,21) |
| InChIKey | PUZXOBWWAQYMJR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |