About (3S,4R)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol;dihydrochloride
(3S,4R)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol;dihydrochloride (PubChem CID 154919479) has the molecular formula C14H18Cl2N2O
and a molecular weight of 301.22 g/mol. Its IUPAC name is (3S,4R)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol;dihydrochloride.
Molecular Properties
| Compound Name | (3S,4R)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol;dihydrochloride |
| PubChem CID | 154919479 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (3S,4R)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol;dihydrochloride |
| SMILES | Cl.Cl.O[C@@H]1CNC[C@H]1Cc1ccc2ccccc2n1 |
| InChI | InChI=1S/C14H16N2O.2ClH/c17-14-9-15-8-11(14)7-12-6-5-10-3-1-2-4-13(10)16-12;;/h1-6,11,14-15,17H,7-9H2;2*1H/t11-,14-;;/m1../s1 |
| InChIKey | ZRZCFPSCKVWCBB-WGSPLUPMSA-N |
| XLogP | 2.20 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4R)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol;dihydrochloride?
The IUPAC name of (3S,4R)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol;dihydrochloride (CID 154919479) is (3S,4R)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol;dihydrochloride.
What is the SMILES notation for (3S,4R)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol;dihydrochloride?
The canonical SMILES for (3S,4R)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol;dihydrochloride is Cl.Cl.O[C@@H]1CNC[C@H]1Cc1ccc2ccccc2n1.
What is the InChIKey of (3S,4R)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol;dihydrochloride?
The InChIKey is ZRZCFPSCKVWCBB-WGSPLUPMSA-N. The full InChI is InChI=1S/C14H16N2O.2ClH/c17-14-9-15-8-11(14)7-12-6-5-10-3-1-2-4-13(10)16-12;;/h1-6,11,14-15,17H,7-9H2;2*1H/t11-,14-;;/m1../s1.
What are the key properties of (3S,4R)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol;dihydrochloride?
(3S,4R)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol;dihydrochloride has a molecular weight of 301.22 g/mol, XLogP of 2.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-4-(quinolin-2-ylmethyl)pyrrolidin-3-ol;dihydrochloride is sourced from PubChem (CID 154919479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).