C15H17NO3 — CID 82159881
3-(2-morpholin-4-yl-2-oxoethyl)-2,3-dihydroinden-1-one (PubChem CID 82159881) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 3-(2-morpholin-4-yl-2-oxoethyl)-2,3-dihydroinden-1-one.
| Compound Name | 3-(2-morpholin-4-yl-2-oxoethyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 82159881 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 3-(2-morpholin-4-yl-2-oxoethyl)-2,3-dihydroinden-1-one |
| SMILES | O=C1CC(CC(=O)N2CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C15H17NO3/c17-14-9-11(12-3-1-2-4-13(12)14)10-15(18)16-5-7-19-8-6-16/h1-4,11H,5-10H2 |
| InChIKey | DGWXJHJQDUZSJI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |