C20H21NO — CID 170552669
2-(9,10-dihydrophenanthren-9-yl)-1-pyrrolidin-1-ylethanone (PubChem CID 170552669) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-(9,10-dihydrophenanthren-9-yl)-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-(9,10-dihydrophenanthren-9-yl)-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 170552669 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2-(9,10-dihydrophenanthren-9-yl)-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(CC1Cc2ccccc2-c2ccccc21)N1CCCC1 |
| InChI | InChI=1S/C20H21NO/c22-20(21-11-5-6-12-21)14-16-13-15-7-1-2-8-17(15)19-10-4-3-9-18(16)19/h1-4,7-10,16H,5-6,11-14H2 |
| InChIKey | MNAOKKTUEYZFJN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |