About biphenylene;2-methoxyethanol
biphenylene;2-methoxyethanol (PubChem CID 69005385) has the molecular formula C15H16O2
and a molecular weight of 228.29 g/mol. Its IUPAC name is biphenylene;2-methoxyethanol.
Molecular Properties
| Compound Name | biphenylene;2-methoxyethanol |
| PubChem CID | 69005385 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | biphenylene;2-methoxyethanol |
| SMILES | COCCO.c1ccc2c(c1)-c1ccccc1-2 |
| InChI | InChI=1S/C12H8.C3H8O2/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;1-5-3-2-4/h1-8H;4H,2-3H2,1H3 |
| InChIKey | QAGQXXUCFKTQEB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze biphenylene;2-methoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of biphenylene;2-methoxyethanol?
The IUPAC name of biphenylene;2-methoxyethanol (CID 69005385) is biphenylene;2-methoxyethanol.
What is the SMILES notation for biphenylene;2-methoxyethanol?
The canonical SMILES for biphenylene;2-methoxyethanol is COCCO.c1ccc2c(c1)-c1ccccc1-2.
What is the InChIKey of biphenylene;2-methoxyethanol?
The InChIKey is QAGQXXUCFKTQEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8.C3H8O2/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;1-5-3-2-4/h1-8H;4H,2-3H2,1H3.
What are the key properties of biphenylene;2-methoxyethanol?
biphenylene;2-methoxyethanol has a molecular weight of 228.29 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for biphenylene;2-methoxyethanol is sourced from PubChem (CID 69005385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).