About 2-hydroxyimino-N'-(3-methoxypropyl)-N,N-dimethylethanimidamide;hydrochloride
2-hydroxyimino-N'-(3-methoxypropyl)-N,N-dimethylethanimidamide;hydrochloride (PubChem CID 136598189) has the molecular formula C8H18ClN3O2
and a molecular weight of 223.70 g/mol. Its IUPAC name is 2-hydroxyimino-N'-(3-methoxypropyl)-N,N-dimethylethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | 2-hydroxyimino-N'-(3-methoxypropyl)-N,N-dimethylethanimidamide;hydrochloride |
| PubChem CID | 136598189 |
| Molecular Formula | C8H18ClN3O2 |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-hydroxyimino-N'-(3-methoxypropyl)-N,N-dimethylethanimidamide;hydrochloride |
| SMILES | COCCC/N=C(/C=NO)N(C)C.Cl |
| InChI | InChI=1S/C8H17N3O2.ClH/c1-11(2)8(7-10-12)9-5-4-6-13-3;/h7,12H,4-6H2,1-3H3;1H/b9-8-,10-7?; |
| InChIKey | RCGQIGKXULZETI-QLBANCNYSA-N |
| XLogP | 0.86 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyimino-N'-(3-methoxypropyl)-N,N-dimethylethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyimino-N'-(3-methoxypropyl)-N,N-dimethylethanimidamide;hydrochloride?
The IUPAC name of 2-hydroxyimino-N'-(3-methoxypropyl)-N,N-dimethylethanimidamide;hydrochloride (CID 136598189) is 2-hydroxyimino-N'-(3-methoxypropyl)-N,N-dimethylethanimidamide;hydrochloride.
What is the SMILES notation for 2-hydroxyimino-N'-(3-methoxypropyl)-N,N-dimethylethanimidamide;hydrochloride?
The canonical SMILES for 2-hydroxyimino-N'-(3-methoxypropyl)-N,N-dimethylethanimidamide;hydrochloride is COCCC/N=C(/C=NO)N(C)C.Cl.
What is the InChIKey of 2-hydroxyimino-N'-(3-methoxypropyl)-N,N-dimethylethanimidamide;hydrochloride?
The InChIKey is RCGQIGKXULZETI-QLBANCNYSA-N. The full InChI is InChI=1S/C8H17N3O2.ClH/c1-11(2)8(7-10-12)9-5-4-6-13-3;/h7,12H,4-6H2,1-3H3;1H/b9-8-,10-7?;.
What are the key properties of 2-hydroxyimino-N'-(3-methoxypropyl)-N,N-dimethylethanimidamide;hydrochloride?
2-hydroxyimino-N'-(3-methoxypropyl)-N,N-dimethylethanimidamide;hydrochloride has a molecular weight of 223.70 g/mol, XLogP of 0.86, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyimino-N'-(3-methoxypropyl)-N,N-dimethylethanimidamide;hydrochloride is sourced from PubChem (CID 136598189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).