C9H19N3O — CID 136598188
2-hydroxyimino-N,N-dimethyl-N'-pentylethanimidamide (PubChem CID 136598188) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-hydroxyimino-N,N-dimethyl-N'-pentylethanimidamide.
| Compound Name | 2-hydroxyimino-N,N-dimethyl-N'-pentylethanimidamide |
|---|---|
| PubChem CID | 136598188 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 2-hydroxyimino-N,N-dimethyl-N'-pentylethanimidamide |
| SMILES | CCCCC/N=C(/C=NO)N(C)C |
| InChI | InChI=1S/C9H19N3O/c1-4-5-6-7-10-9(8-11-13)12(2)3/h8,13H,4-7H2,1-3H3/b10-9-,11-8? |
| InChIKey | FGGDEBNQOUZMTE-LRYJFLPDSA-N |
| XLogP | 1.60 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|