C7H18IN3 — CID 130748355
2-butyl-1,1-dimethylguanidine;hydroiodide (PubChem CID 130748355) has the molecular formula C7H18IN3 and a molecular weight of 271.15 g/mol. Its IUPAC name is 2-butyl-1,1-dimethylguanidine;hydroiodide.
| Compound Name | 2-butyl-1,1-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 130748355 |
| Molecular Formula | C7H18IN3 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 2-butyl-1,1-dimethylguanidine;hydroiodide |
| SMILES | CCCC/N=C(\N)N(C)C.I |
| InChI | InChI=1S/C7H17N3.HI/c1-4-5-6-9-7(8)10(2)3;/h4-6H2,1-3H3,(H2,8,9);1H |
| InChIKey | QFABUAUZYOFOOB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|