About 2-[(N'-dodecylcarbamimidoyl)-methylamino]acetic acid
2-[(N'-dodecylcarbamimidoyl)-methylamino]acetic acid (PubChem CID 87453757) has the molecular formula C16H33N3O2
and a molecular weight of 299.46 g/mol. Its IUPAC name is 2-[(N'-dodecylcarbamimidoyl)-methylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[(N'-dodecylcarbamimidoyl)-methylamino]acetic acid |
| PubChem CID | 87453757 |
| Molecular Formula | C16H33N3O2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | 2-[(N'-dodecylcarbamimidoyl)-methylamino]acetic acid |
| SMILES | CCCCCCCCCCCC/N=C(\N)N(C)CC(=O)O |
| InChI | InChI=1S/C16H33N3O2/c1-3-4-5-6-7-8-9-10-11-12-13-18-16(17)19(2)14-15(20)21/h3-14H2,1-2H3,(H2,17,18)(H,20,21) |
| InChIKey | CHXHSPODKDKFTD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(N'-dodecylcarbamimidoyl)-methylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(N'-dodecylcarbamimidoyl)-methylamino]acetic acid?
The IUPAC name of 2-[(N'-dodecylcarbamimidoyl)-methylamino]acetic acid (CID 87453757) is 2-[(N'-dodecylcarbamimidoyl)-methylamino]acetic acid.
What is the SMILES notation for 2-[(N'-dodecylcarbamimidoyl)-methylamino]acetic acid?
The canonical SMILES for 2-[(N'-dodecylcarbamimidoyl)-methylamino]acetic acid is CCCCCCCCCCCC/N=C(\N)N(C)CC(=O)O.
What is the InChIKey of 2-[(N'-dodecylcarbamimidoyl)-methylamino]acetic acid?
The InChIKey is CHXHSPODKDKFTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33N3O2/c1-3-4-5-6-7-8-9-10-11-12-13-18-16(17)19(2)14-15(20)21/h3-14H2,1-2H3,(H2,17,18)(H,20,21).
What are the key properties of 2-[(N'-dodecylcarbamimidoyl)-methylamino]acetic acid?
2-[(N'-dodecylcarbamimidoyl)-methylamino]acetic acid has a molecular weight of 299.46 g/mol, XLogP of 3.24, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(N'-dodecylcarbamimidoyl)-methylamino]acetic acid is sourced from PubChem (CID 87453757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).