C11H24N2O3 — CID 173151515
carbonic acid;N'-hexyl-N,N-dimethylethanimidamide (PubChem CID 173151515) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is carbonic acid;N'-hexyl-N,N-dimethylethanimidamide.
| Compound Name | carbonic acid;N'-hexyl-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 173151515 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | carbonic acid;N'-hexyl-N,N-dimethylethanimidamide |
| SMILES | CCCCCC/N=C(\C)N(C)C.O=C(O)O |
| InChI | InChI=1S/C10H22N2.CH2O3/c1-5-6-7-8-9-11-10(2)12(3)4;2-1(3)4/h5-9H2,1-4H3;(H2,2,3,4)/b11-10+; |
| InChIKey | XVZAZHJGELRGON-ASTDGNLGSA-N |
| XLogP | 2.77 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|