C10H23N5 — CID 71332601
1,2-dibutyl-1-carbamimidoylguanidine (PubChem CID 71332601) has the molecular formula C10H23N5 and a molecular weight of 213.33 g/mol. Its IUPAC name is 1,2-dibutyl-1-carbamimidoylguanidine.
| Compound Name | 1,2-dibutyl-1-carbamimidoylguanidine |
|---|---|
| PubChem CID | 71332601 |
| Molecular Formula | C10H23N5 |
| Molecular Weight | 213.33 g/mol |
| Exact Mass | 213.20 |
| IUPAC Name | 1,2-dibutyl-1-carbamimidoylguanidine |
| SMILES | [H]/N=C(\N)N(CCCC)/C(N)=N/CCCC |
| InChI | InChI=1S/C10H23N5/c1-3-5-7-14-10(13)15(9(11)12)8-6-4-2/h3-8H2,1-2H3,(H3,11,12)(H2,13,14) |
| InChIKey | MQHITEYVWUYXON-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|