C8H20N6 — CID 176532426
1-carbamimidamido-2-hexylguanidine (PubChem CID 176532426) has the molecular formula C8H20N6 and a molecular weight of 200.29 g/mol. Its IUPAC name is 1-carbamimidamido-2-hexylguanidine.
| Compound Name | 1-carbamimidamido-2-hexylguanidine |
|---|---|
| PubChem CID | 176532426 |
| Molecular Formula | C8H20N6 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.17 |
| IUPAC Name | 1-carbamimidamido-2-hexylguanidine |
| SMILES | [H]/N=C(\N)NN/C(N)=N/CCCCCC |
| InChI | InChI=1S/C8H20N6/c1-2-3-4-5-6-12-8(11)14-13-7(9)10/h2-6H2,1H3,(H4,9,10,13)(H3,11,12,14) |
| InChIKey | KYSVNWIPJOXOFD-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|