C9H22ClN5 — CID 176524917
1,1-dimethyl-3-(N'-pentylcarbamimidoyl)guanidine;hydrochloride (PubChem CID 176524917) has the molecular formula C9H22ClN5 and a molecular weight of 235.76 g/mol. Its IUPAC name is 1,1-dimethyl-3-(N'-pentylcarbamimidoyl)guanidine;hydrochloride.
| Compound Name | 1,1-dimethyl-3-(N'-pentylcarbamimidoyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 176524917 |
| Molecular Formula | C9H22ClN5 |
| Molecular Weight | 235.76 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1,1-dimethyl-3-(N'-pentylcarbamimidoyl)guanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(/N/C(N)=N/CCCCC)N(C)C |
| InChI | InChI=1S/C9H21N5.ClH/c1-4-5-6-7-12-8(10)13-9(11)14(2)3;/h4-7H2,1-3H3,(H4,10,11,12,13);1H |
| InChIKey | SDTAORIRZCGREK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.76 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|