C19H41ClN6 — CID 176533213
N-(N'-dodecylcarbamimidoyl)-4-methylpiperazine-1-carboximidamide;hydrochloride (PubChem CID 176533213) has the molecular formula C19H41ClN6 and a molecular weight of 389.03 g/mol. Its IUPAC name is N-(N'-dodecylcarbamimidoyl)-4-methylpiperazine-1-carboximidamide;hydrochloride.
| Compound Name | N-(N'-dodecylcarbamimidoyl)-4-methylpiperazine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 176533213 |
| Molecular Formula | C19H41ClN6 |
| Molecular Weight | 389.03 g/mol |
| Exact Mass | 388.31 |
| IUPAC Name | N-(N'-dodecylcarbamimidoyl)-4-methylpiperazine-1-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N/C(N)=N/CCCCCCCCCCCC)N1CCN(C)CC1 |
| InChI | InChI=1S/C19H40N6.ClH/c1-3-4-5-6-7-8-9-10-11-12-13-22-18(20)23-19(21)25-16-14-24(2)15-17-25;/h3-17H2,1-2H3,(H4,20,21,22,23);1H |
| InChIKey | NFQNSIVUAWLNOJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.03 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|