C8H19N5 — CID 176518606
2-butyl-1-carbamimidoyl-3-ethylguanidine (PubChem CID 176518606) has the molecular formula C8H19N5 and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-butyl-1-carbamimidoyl-3-ethylguanidine.
| Compound Name | 2-butyl-1-carbamimidoyl-3-ethylguanidine |
|---|---|
| PubChem CID | 176518606 |
| Molecular Formula | C8H19N5 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | 2-butyl-1-carbamimidoyl-3-ethylguanidine |
| SMILES | [H]/N=C(\N)N/C(=N/CCCC)NCC |
| InChI | InChI=1S/C8H19N5/c1-3-5-6-12-8(11-4-2)13-7(9)10/h3-6H2,1-2H3,(H5,9,10,11,12,13) |
| InChIKey | KREZRKULMRIOKR-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|