C11H26N4O2 — CID 170732226
2-aminoacetic acid;2-butyl-1,3-diethylguanidine (PubChem CID 170732226) has the molecular formula C11H26N4O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-aminoacetic acid;2-butyl-1,3-diethylguanidine.
| Compound Name | 2-aminoacetic acid;2-butyl-1,3-diethylguanidine |
|---|---|
| PubChem CID | 170732226 |
| Molecular Formula | C11H26N4O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 2-aminoacetic acid;2-butyl-1,3-diethylguanidine |
| SMILES | CCCCN=C(NCC)NCC.NCC(=O)O |
| InChI | InChI=1S/C9H21N3.C2H5NO2/c1-4-7-8-12-9(10-5-2)11-6-3;3-1-2(4)5/h4-8H2,1-3H3,(H2,10,11,12);1,3H2,(H,4,5) |
| InChIKey | LLBSDTATFIMCGN-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|