C9H21N3S2 — CID 87544034
1,1-bis(butylsulfanyl)guanidine (PubChem CID 87544034) has the molecular formula C9H21N3S2 and a molecular weight of 235.42 g/mol. Its IUPAC name is 1,1-bis(butylsulfanyl)guanidine.
| Compound Name | 1,1-bis(butylsulfanyl)guanidine |
|---|---|
| PubChem CID | 87544034 |
| Molecular Formula | C9H21N3S2 |
| Molecular Weight | 235.42 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1,1-bis(butylsulfanyl)guanidine |
| SMILES | [H]/N=C(\N)N(SCCCC)SCCCC |
| InChI | InChI=1S/C9H21N3S2/c1-3-5-7-13-12(9(10)11)14-8-6-4-2/h3-8H2,1-2H3,(H3,10,11) |
| InChIKey | RXBSYTCFORARMQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|