About tributyl-(N'-butyl-N,N-dimethylcarbamimidoyl)azanium
tributyl-(N'-butyl-N,N-dimethylcarbamimidoyl)azanium (PubChem CID 163212745) has the molecular formula C19H42N3+
and a molecular weight of 312.57 g/mol. Its IUPAC name is tributyl-(N'-butyl-N,N-dimethylcarbamimidoyl)azanium.
Molecular Properties
| Compound Name | tributyl-(N'-butyl-N,N-dimethylcarbamimidoyl)azanium |
| PubChem CID | 163212745 |
| Molecular Formula | C19H42N3+ |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.34 |
| IUPAC Name | tributyl-(N'-butyl-N,N-dimethylcarbamimidoyl)azanium |
| SMILES | CCCC/N=C(\N(C)C)[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C19H42N3/c1-7-11-15-20-19(21(5)6)22(16-12-8-2,17-13-9-3)18-14-10-4/h7-18H2,1-6H3/q+1/b20-19+ |
| InChIKey | QSXNUHDWHONMGH-FMQUCBEESA-N |
| XLogP | 4.92 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tributyl-(N'-butyl-N,N-dimethylcarbamimidoyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-(N'-butyl-N,N-dimethylcarbamimidoyl)azanium?
The IUPAC name of tributyl-(N'-butyl-N,N-dimethylcarbamimidoyl)azanium (CID 163212745) is tributyl-(N'-butyl-N,N-dimethylcarbamimidoyl)azanium.
What is the SMILES notation for tributyl-(N'-butyl-N,N-dimethylcarbamimidoyl)azanium?
The canonical SMILES for tributyl-(N'-butyl-N,N-dimethylcarbamimidoyl)azanium is CCCC/N=C(\N(C)C)[N+](CCCC)(CCCC)CCCC.
What is the InChIKey of tributyl-(N'-butyl-N,N-dimethylcarbamimidoyl)azanium?
The InChIKey is QSXNUHDWHONMGH-FMQUCBEESA-N. The full InChI is InChI=1S/C19H42N3/c1-7-11-15-20-19(21(5)6)22(16-12-8-2,17-13-9-3)18-14-10-4/h7-18H2,1-6H3/q+1/b20-19+.
What are the key properties of tributyl-(N'-butyl-N,N-dimethylcarbamimidoyl)azanium?
tributyl-(N'-butyl-N,N-dimethylcarbamimidoyl)azanium has a molecular weight of 312.57 g/mol, XLogP of 4.92, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-(N'-butyl-N,N-dimethylcarbamimidoyl)azanium is sourced from PubChem (CID 163212745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).