C11H24N2 — CID 525910
N,N,2-trimethyl-N'-pentylpropanimidamide (PubChem CID 525910) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is N,N,2-trimethyl-N'-pentylpropanimidamide.
| Compound Name | N,N,2-trimethyl-N'-pentylpropanimidamide |
|---|---|
| PubChem CID | 525910 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | N,N,2-trimethyl-N'-pentylpropanimidamide |
| SMILES | CCCCC/N=C(\C(C)C)N(C)C |
| InChI | InChI=1S/C11H24N2/c1-6-7-8-9-12-11(10(2)3)13(4)5/h10H,6-9H2,1-5H3/b12-11+ |
| InChIKey | TTYVDSFXAAKXCM-VAWYXSNFSA-N |
| XLogP | 2.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|