C14H33N3Si — CID 159110043
1-(dimethylsilylmethyl)-2-heptyl-1,3,3-trimethylguanidine (PubChem CID 159110043) has the molecular formula C14H33N3Si and a molecular weight of 271.52 g/mol. Its IUPAC name is 1-(dimethylsilylmethyl)-2-heptyl-1,3,3-trimethylguanidine.
| Compound Name | 1-(dimethylsilylmethyl)-2-heptyl-1,3,3-trimethylguanidine |
|---|---|
| PubChem CID | 159110043 |
| Molecular Formula | C14H33N3Si |
| Molecular Weight | 271.52 g/mol |
| Exact Mass | 271.24 |
| IUPAC Name | 1-(dimethylsilylmethyl)-2-heptyl-1,3,3-trimethylguanidine |
| SMILES | CCCCCCC/N=C(\N(C)C)N(C)C[SiH](C)C |
| InChI | InChI=1S/C14H33N3Si/c1-7-8-9-10-11-12-15-14(16(2)3)17(4)13-18(5)6/h18H,7-13H2,1-6H3/b15-14+ |
| InChIKey | KEJKDXCPCHOYQO-CCEZHUSRSA-N |
| XLogP | 2.83 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|