About methyl N-decylethanimidate
methyl N-decylethanimidate (PubChem CID 51355250) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is methyl N-decylethanimidate.
Molecular Properties
| Compound Name | methyl N-decylethanimidate |
| PubChem CID | 51355250 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | methyl N-decylethanimidate |
| SMILES | CCCCCCCCCC/N=C(\C)OC |
| InChI | InChI=1S/C13H27NO/c1-4-5-6-7-8-9-10-11-12-14-13(2)15-3/h4-12H2,1-3H3/b14-13+ |
| InChIKey | QVFBZILAMDHYIT-BUHFOSPRSA-N |
| XLogP | 4.19 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-decylethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-decylethanimidate?
The IUPAC name of methyl N-decylethanimidate (CID 51355250) is methyl N-decylethanimidate.
What is the SMILES notation for methyl N-decylethanimidate?
The canonical SMILES for methyl N-decylethanimidate is CCCCCCCCCC/N=C(\C)OC.
What is the InChIKey of methyl N-decylethanimidate?
The InChIKey is QVFBZILAMDHYIT-BUHFOSPRSA-N. The full InChI is InChI=1S/C13H27NO/c1-4-5-6-7-8-9-10-11-12-14-13(2)15-3/h4-12H2,1-3H3/b14-13+.
What are the key properties of methyl N-decylethanimidate?
methyl N-decylethanimidate has a molecular weight of 213.36 g/mol, XLogP of 4.19, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-decylethanimidate is sourced from PubChem (CID 51355250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).