About propyl N-butylethanimidate
propyl N-butylethanimidate (PubChem CID 155161366) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is propyl N-butylethanimidate.
Molecular Properties
| Compound Name | propyl N-butylethanimidate |
| PubChem CID | 155161366 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | propyl N-butylethanimidate |
| SMILES | CCCC/N=C(\C)OCCC |
| InChI | InChI=1S/C9H19NO/c1-4-6-7-10-9(3)11-8-5-2/h4-8H2,1-3H3/b10-9+ |
| InChIKey | GCEJBCKQIMQXHZ-MDZDMXLPSA-N |
| XLogP | 2.63 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze propyl N-butylethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl N-butylethanimidate?
The IUPAC name of propyl N-butylethanimidate (CID 155161366) is propyl N-butylethanimidate.
What is the SMILES notation for propyl N-butylethanimidate?
The canonical SMILES for propyl N-butylethanimidate is CCCC/N=C(\C)OCCC.
What is the InChIKey of propyl N-butylethanimidate?
The InChIKey is GCEJBCKQIMQXHZ-MDZDMXLPSA-N. The full InChI is InChI=1S/C9H19NO/c1-4-6-7-10-9(3)11-8-5-2/h4-8H2,1-3H3/b10-9+.
What are the key properties of propyl N-butylethanimidate?
propyl N-butylethanimidate has a molecular weight of 157.26 g/mol, XLogP of 2.63, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propyl N-butylethanimidate is sourced from PubChem (CID 155161366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).