C12H26N4O2 — CID 136854400
1-N,2-N-dihydroxy-1-N',2-N'-dipentylethanediimidamide (PubChem CID 136854400) has the molecular formula C12H26N4O2 and a molecular weight of 258.37 g/mol. Its IUPAC name is 1-N,2-N-dihydroxy-1-N',2-N'-dipentylethanediimidamide.
| Compound Name | 1-N,2-N-dihydroxy-1-N',2-N'-dipentylethanediimidamide |
|---|---|
| PubChem CID | 136854400 |
| Molecular Formula | C12H26N4O2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1-N,2-N-dihydroxy-1-N',2-N'-dipentylethanediimidamide |
| SMILES | CCCCC/N=C(NO)/C(=N/CCCCC)NO |
| InChI | InChI=1S/C12H26N4O2/c1-3-5-7-9-13-11(15-17)12(16-18)14-10-8-6-4-2/h17-18H,3-10H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | QWFPHNFOQCJDMK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|