C14H22N2O — CID 525616
N'-butyl-4-methoxy-N,N-dimethylbenzenecarboximidamide (PubChem CID 525616) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is N'-butyl-4-methoxy-N,N-dimethylbenzenecarboximidamide.
| Compound Name | N'-butyl-4-methoxy-N,N-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 525616 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N'-butyl-4-methoxy-N,N-dimethylbenzenecarboximidamide |
| SMILES | CCCC/N=C(/c1ccc(OC)cc1)N(C)C |
| InChI | InChI=1S/C14H22N2O/c1-5-6-11-15-14(16(2)3)12-7-9-13(17-4)10-8-12/h7-10H,5-6,11H2,1-4H3/b15-14- |
| InChIKey | TYSVTMBBVZFYJU-PFONDFGASA-N |
| XLogP | 2.80 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|