C19H32N2O — CID 525636
4-methoxy-N,N-dimethyl-N'-nonylbenzenecarboximidamide (PubChem CID 525636) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is 4-methoxy-N,N-dimethyl-N'-nonylbenzenecarboximidamide.
| Compound Name | 4-methoxy-N,N-dimethyl-N'-nonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 525636 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | 4-methoxy-N,N-dimethyl-N'-nonylbenzenecarboximidamide |
| SMILES | CCCCCCCCC/N=C(/c1ccc(OC)cc1)N(C)C |
| InChI | InChI=1S/C19H32N2O/c1-5-6-7-8-9-10-11-16-20-19(21(2)3)17-12-14-18(22-4)15-13-17/h12-15H,5-11,16H2,1-4H3/b20-19- |
| InChIKey | LZJXDRYMQKFDRG-VXPUYCOJSA-N |
| XLogP | 4.75 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|